Pin-zenphone2-C11P1424(3)

380,000 

Pin Zenfone 2 C11P1424

Nguồn gốc: Phụ kiện cao cấp

Dung lượng: 3000mAh

Điện áp sạc định mức: 3.7V

Điện áp sạc giới hạn: 4.2V

Loại pin: Pin Polymer

Loại hình bảo hành: Bằng tem bảo hành và hóa đơn

Mua ngay